C62H66N4O — CID 158049407
2-[3-[4-tert-butyl-3-(3,5-ditert-butylphenyl)-2H-imidazol-3-ium-2-id-1-yl]phenoxy]-7-(2-phenylpropan-2-yl)-9-[4-(2-phenylpropan-2-yl)-2-pyridinyl]carbazole (PubChem CID 158049407) has the molecular formula C62H66N4O and a molecular weight of 883.24 g/mol. Its IUPAC name is 2-[3-[4-tert-butyl-3-(3,5-ditert-butylphenyl)-2H-imidazol-3-ium-2-id-1-yl]phenoxy]-7-(2-phenylpropan-2-yl)-9-[4-(2-phenylpropan-2-yl)-2-pyridinyl]carbazole.
| Compound Name | 2-[3-[4-tert-butyl-3-(3,5-ditert-butylphenyl)-2H-imidazol-3-ium-2-id-1-yl]phenoxy]-7-(2-phenylpropan-2-yl)-9-[4-(2-phenylpropan-2-yl)-2-pyridinyl]carbazole |
|---|---|
| PubChem CID | 158049407 |
| Molecular Formula | C62H66N4O |
| Molecular Weight | 883.24 g/mol |
| Exact Mass | 882.52 |
| IUPAC Name | 2-[3-[4-tert-butyl-3-(3,5-ditert-butylphenyl)-2H-imidazol-3-ium-2-id-1-yl]phenoxy]-7-(2-phenylpropan-2-yl)-9-[4-(2-phenylpropan-2-yl)-2-pyridinyl]carbazole |
| SMILES | CC(C)(C)c1cc(-[n+]2[c-]n(-c3cccc(Oc4ccc5c6ccc(C(C)(C)c7ccccc7)cc6n(-c6cc(C(C)(C)c7ccccc7)ccn6)c5c4)c3)cc2C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C62H66N4O/c1-58(2,3)46-33-47(59(4,5)6)35-49(34-46)65-41-64(40-56(65)60(7,8)9)48-25-20-26-50(38-48)67-51-28-30-53-52-29-27-44(61(10,11)42-21-16-14-17-22-42)36-54(52)66(55(53)39-51)57-37-45(31-32-63-57)62(12,13)43-23-18-15-19-24-43/h14-40H,1-13H3 |
| InChIKey | VUSYUZIBCUVFAX-UHFFFAOYSA-N |
| XLogP | 15.38 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.24 |
| LogP ≤ 5 | 15.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|