C61H57N5O — CID 170654752
CID 170654752 (PubChem CID 170654752) has the molecular formula C61H57N5O and a molecular weight of 876.16 g/mol.
| Compound Name | CID 170654752 |
|---|---|
| PubChem CID | 170654752 |
| Molecular Formula | C61H57N5O |
| Molecular Weight | 876.16 g/mol |
| Exact Mass | 875.46 |
| IUPAC Name | — |
| SMILES | Cc1cccc(-c2ccccc2)c1-c1nn(-c2cccc(Oc3ccc4c5ccccc5n(-c5cc(C(C)(C)c6ccccc6)ccn5)c4c3)c2)[c-][n+]1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C61H57N5O/c1-41-20-18-28-51(42-21-12-10-13-22-42)57(41)58-63-65(40-64(58)48-35-45(59(2,3)4)34-46(36-48)60(5,6)7)47-25-19-26-49(38-47)67-50-30-31-53-52-27-16-17-29-54(52)66(55(53)39-50)56-37-44(32-33-62-56)61(8,9)43-23-14-11-15-24-43/h10-39H,1-9H3 |
| InChIKey | DTAPABGEAIXRPF-UHFFFAOYSA-N |
| XLogP | 14.80 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.16 |
| LogP ≤ 5 | 14.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|