C56H39N5O — CID 170654728
CID 170654728 (PubChem CID 170654728) has the molecular formula C56H39N5O and a molecular weight of 797.96 g/mol.
| Compound Name | CID 170654728 |
|---|---|
| PubChem CID | 170654728 |
| Molecular Formula | C56H39N5O |
| Molecular Weight | 797.96 g/mol |
| Exact Mass | 797.32 |
| IUPAC Name | — |
| SMILES | Cc1cc(-n2c3ccccc3c3ccc(Oc4cccc(-n5[c-][n+](-c6c(-c7ccccc7)cccc6-c6ccccc6)c(-c6ccccc6)n5)c4)cc32)ncc1-c1ccccc1 |
| InChI | InChI=1S/C56H39N5O/c1-39-34-54(57-37-51(39)42-22-10-4-11-23-42)61-52-31-15-14-28-49(52)50-33-32-46(36-53(50)61)62-45-27-16-26-44(35-45)60-38-59(56(58-60)43-24-12-5-13-25-43)55-47(40-18-6-2-7-19-40)29-17-30-48(55)41-20-8-3-9-21-41/h2-37H,1H3 |
| InChIKey | LVLSCZDZHDJHTQ-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.96 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|