C65H50N6O — CID 170654592
CID 170654592 (PubChem CID 170654592) has the molecular formula C65H50N6O and a molecular weight of 931.16 g/mol.
| Compound Name | CID 170654592 |
|---|---|
| PubChem CID | 170654592 |
| Molecular Formula | C65H50N6O |
| Molecular Weight | 931.16 g/mol |
| Exact Mass | 930.40 |
| IUPAC Name | — |
| SMILES | Cc1cc(-n2c3ccc(-c4ccccc4)cc3c3ccc(Oc4cc(-n5[c-][n+](-c6c(-c7ccccc7)cccc6-c6ccccc6)c(-c6ccccc6)n5)nc(C(C)(C)C)c4)cc32)ncc1-c1ccccc1 |
| InChI | InChI=1S/C65H50N6O/c1-44-37-61(66-42-57(44)48-27-16-8-17-28-48)71-58-36-33-50(45-21-10-5-11-22-45)38-56(58)55-35-34-51(39-59(55)71)72-52-40-60(65(2,3)4)67-62(41-52)70-43-69(64(68-70)49-29-18-9-19-30-49)63-53(46-23-12-6-13-24-46)31-20-32-54(63)47-25-14-7-15-26-47/h5-42H,1-4H3 |
| InChIKey | LGIFXHJBWFYRFP-UHFFFAOYSA-N |
| XLogP | 15.57 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.16 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|