C59H44N6OPt-2 — CID 170654690
CID 170654690 (PubChem CID 170654690) has the molecular formula C59H44N6OPt-2 and a molecular weight of 1048.12 g/mol.
| Compound Name | CID 170654690 |
|---|---|
| PubChem CID | 170654690 |
| Molecular Formula | C59H44N6OPt-2 |
| Molecular Weight | 1048.12 g/mol |
| Exact Mass | 1047.32 |
| IUPAC Name | — |
| SMILES | Cc1cc(-n2c3[c-]c(Oc4[c-]c(-n5[c-][n+](-c6c(-c7ccccc7)cccc6-c6ccccc6)c(-c6ccccc6)n5)nc(C(C)(C)C)c4)ccc3c3ccccc32)ncc1-c1ccccc1.[Pt] |
| InChI | InChI=1S/C59H44N6O.Pt/c1-40-34-55(60-38-51(40)43-24-13-7-14-25-43)65-52-31-18-17-28-49(52)50-33-32-45(35-53(50)65)66-46-36-54(59(2,3)4)61-56(37-46)64-39-63(58(62-64)44-26-15-8-16-27-44)57-47(41-20-9-5-10-21-41)29-19-30-48(57)42-22-11-6-12-23-42;/h5-34,36,38H,1-4H3;/q-2; |
| InChIKey | JPSZVDMUGOAFQA-UHFFFAOYSA-N |
| XLogP | 13.50 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1048.12 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|