C24H16I7NO3 — CID 158051419
N-(4-acetyl-2,6-diiodophenyl)-3,4-diiodo-5-methylbenzamide;1-(3,4,5-triiodophenyl)ethanone (PubChem CID 158051419) has the molecular formula C24H16I7NO3 and a molecular weight of 1254.72 g/mol. Its IUPAC name is N-(4-acetyl-2,6-diiodophenyl)-3,4-diiodo-5-methylbenzamide;1-(3,4,5-triiodophenyl)ethanone.
| Compound Name | N-(4-acetyl-2,6-diiodophenyl)-3,4-diiodo-5-methylbenzamide;1-(3,4,5-triiodophenyl)ethanone |
|---|---|
| PubChem CID | 158051419 |
| Molecular Formula | C24H16I7NO3 |
| Molecular Weight | 1254.72 g/mol |
| Exact Mass | 1254.44 |
| IUPAC Name | N-(4-acetyl-2,6-diiodophenyl)-3,4-diiodo-5-methylbenzamide;1-(3,4,5-triiodophenyl)ethanone |
| SMILES | CC(=O)c1cc(I)c(I)c(I)c1.CC(=O)c1cc(I)c(NC(=O)c2cc(C)c(I)c(I)c2)c(I)c1 |
| InChI | InChI=1S/C16H11I4NO2.C8H5I3O/c1-7-3-10(6-11(17)14(7)20)16(23)21-15-12(18)4-9(8(2)22)5-13(15)19;1-4(12)5-2-6(9)8(11)7(10)3-5/h3-6H,1-2H3,(H,21,23);2-3H,1H3 |
| InChIKey | FJNLHIIZRVIRBG-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1254.72 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|