C27H23BrF2N2O4 — CID 158054159
tert-butyl (3R)-3-[3-bromo-5-(1,3-dioxoisoindol-2-yl)-2-pyridinyl]-4-(3,5-difluorophenyl)butanoate (PubChem CID 158054159) has the molecular formula C27H23BrF2N2O4 and a molecular weight of 557.39 g/mol. Its IUPAC name is tert-butyl (3R)-3-[3-bromo-5-(1,3-dioxoisoindol-2-yl)-2-pyridinyl]-4-(3,5-difluorophenyl)butanoate.
| Compound Name | tert-butyl (3R)-3-[3-bromo-5-(1,3-dioxoisoindol-2-yl)-2-pyridinyl]-4-(3,5-difluorophenyl)butanoate |
|---|---|
| PubChem CID | 158054159 |
| Molecular Formula | C27H23BrF2N2O4 |
| Molecular Weight | 557.39 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | tert-butyl (3R)-3-[3-bromo-5-(1,3-dioxoisoindol-2-yl)-2-pyridinyl]-4-(3,5-difluorophenyl)butanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](Cc1cc(F)cc(F)c1)c1ncc(N2C(=O)c3ccccc3C2=O)cc1Br |
| InChI | InChI=1S/C27H23BrF2N2O4/c1-27(2,3)36-23(33)11-16(8-15-9-17(29)12-18(30)10-15)24-22(28)13-19(14-31-24)32-25(34)20-6-4-5-7-21(20)26(32)35/h4-7,9-10,12-14,16H,8,11H2,1-3H3/t16-/m1/s1 |
| InChIKey | STVLXIILMQAZMO-MRXNPFEDSA-N |
| XLogP | 5.98 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.39 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|