C19H21BBrF2NO4 — CID 158221967
[6-bromo-2-[(2R)-1-(3,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]-3-pyridinyl]boronic acid (PubChem CID 158221967) has the molecular formula C19H21BBrF2NO4 and a molecular weight of 456.09 g/mol. Its IUPAC name is [6-bromo-2-[(2R)-1-(3,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]-3-pyridinyl]boronic acid.
| Compound Name | [6-bromo-2-[(2R)-1-(3,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 158221967 |
| Molecular Formula | C19H21BBrF2NO4 |
| Molecular Weight | 456.09 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | [6-bromo-2-[(2R)-1-(3,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]-3-pyridinyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)C[C@@H](Cc1cc(F)cc(F)c1)c1nc(Br)ccc1B(O)O |
| InChI | InChI=1S/C19H21BBrF2NO4/c1-19(2,3)28-17(25)9-12(6-11-7-13(22)10-14(23)8-11)18-15(20(26)27)4-5-16(21)24-18/h4-5,7-8,10,12,26-27H,6,9H2,1-3H3/t12-/m1/s1 |
| InChIKey | HJHHBSPREBYSSF-GFCCVEGCSA-N |
| XLogP | 2.86 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.09 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|