C13H9Br2F2N2 — CID 153435889
CID 153435889 (PubChem CID 153435889) has the molecular formula C13H9Br2F2N2 and a molecular weight of 391.03 g/mol.
| Compound Name | CID 153435889 |
|---|---|
| PubChem CID | 153435889 |
| Molecular Formula | C13H9Br2F2N2 |
| Molecular Weight | 391.03 g/mol |
| Exact Mass | 388.91 |
| IUPAC Name | — |
| SMILES | [NH][C@@H](Cc1cc(F)cc(F)c1)c1nc(Br)ccc1Br |
| InChI | InChI=1S/C13H9Br2F2N2/c14-10-1-2-12(15)19-13(10)11(18)5-7-3-8(16)6-9(17)4-7/h1-4,6,11,18H,5H2/t11-/m0/s1 |
| InChIKey | IQRWLFDOQZCSIE-NSHDSACASA-N |
| XLogP | 4.45 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.03 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|