C24H27BrF2N2O2 — CID 123363925
tert-butyl N-[1-[3-bromo-6-(3,3-dimethylbut-1-ynyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]carbamate (PubChem CID 123363925) has the molecular formula C24H27BrF2N2O2 and a molecular weight of 493.39 g/mol. Its IUPAC name is tert-butyl N-[1-[3-bromo-6-(3,3-dimethylbut-1-ynyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[3-bromo-6-(3,3-dimethylbut-1-ynyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 123363925 |
| Molecular Formula | C24H27BrF2N2O2 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | tert-butyl N-[1-[3-bromo-6-(3,3-dimethylbut-1-ynyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]carbamate |
| SMILES | CC(C)(C)C#Cc1ccc(Br)c(C(Cc2cc(F)cc(F)c2)NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C24H27BrF2N2O2/c1-23(2,3)10-9-18-7-8-19(25)21(28-18)20(29-22(30)31-24(4,5)6)13-15-11-16(26)14-17(27)12-15/h7-8,11-12,14,20H,13H2,1-6H3,(H,29,30) |
| InChIKey | RWLKXTDOFZOCNY-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|