C24H29Br2F2N3O3 — CID 162530480
tert-butyl N-[1-[3,6-dibromo-5-(cyclopropanecarbonylamino)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]carbamate;ethane (PubChem CID 162530480) has the molecular formula C24H29Br2F2N3O3 and a molecular weight of 605.32 g/mol. Its IUPAC name is tert-butyl N-[1-[3,6-dibromo-5-(cyclopropanecarbonylamino)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]carbamate;ethane.
| Compound Name | tert-butyl N-[1-[3,6-dibromo-5-(cyclopropanecarbonylamino)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]carbamate;ethane |
|---|---|
| PubChem CID | 162530480 |
| Molecular Formula | C24H29Br2F2N3O3 |
| Molecular Weight | 605.32 g/mol |
| Exact Mass | 603.05 |
| IUPAC Name | tert-butyl N-[1-[3,6-dibromo-5-(cyclopropanecarbonylamino)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NC(Cc1cc(F)cc(F)c1)c1nc(Br)c(NC(=O)C2CC2)cc1Br |
| InChI | InChI=1S/C22H23Br2F2N3O3.C2H6/c1-22(2,3)32-21(31)28-16(8-11-6-13(25)9-14(26)7-11)18-15(23)10-17(19(24)29-18)27-20(30)12-4-5-12;1-2/h6-7,9-10,12,16H,4-5,8H2,1-3H3,(H,27,30)(H,28,31);1-2H3 |
| InChIKey | UTIZMZJURJKLLZ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.32 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|