C18H20BBrF2N2O4 — CID 90375598
[6-bromo-2-[2-(3,5-difluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-pyridinyl]boronic acid (PubChem CID 90375598) has the molecular formula C18H20BBrF2N2O4 and a molecular weight of 457.08 g/mol. Its IUPAC name is [6-bromo-2-[2-(3,5-difluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-pyridinyl]boronic acid.
| Compound Name | [6-bromo-2-[2-(3,5-difluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 90375598 |
| Molecular Formula | C18H20BBrF2N2O4 |
| Molecular Weight | 457.08 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | [6-bromo-2-[2-(3,5-difluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-pyridinyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cc(F)cc(F)c1)c1nc(Br)ccc1B(O)O |
| InChI | InChI=1S/C18H20BBrF2N2O4/c1-18(2,3)28-17(25)23-14(8-10-6-11(21)9-12(22)7-10)16-13(19(26)27)4-5-15(20)24-16/h4-7,9,14,26-27H,8H2,1-3H3,(H,23,25) |
| InChIKey | HQDCNTAQVNNQFF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.08 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|