C20H23BrF2N2O — CID 144694190
4-[6-[1-amino-2-(3,5-difluorophenyl)ethyl]-5-bromo-2-pyridinyl]-2-methylbut-3-yn-2-ol;ethane (PubChem CID 144694190) has the molecular formula C20H23BrF2N2O and a molecular weight of 425.32 g/mol. Its IUPAC name is 4-[6-[1-amino-2-(3,5-difluorophenyl)ethyl]-5-bromo-2-pyridinyl]-2-methylbut-3-yn-2-ol;ethane.
| Compound Name | 4-[6-[1-amino-2-(3,5-difluorophenyl)ethyl]-5-bromo-2-pyridinyl]-2-methylbut-3-yn-2-ol;ethane |
|---|---|
| PubChem CID | 144694190 |
| Molecular Formula | C20H23BrF2N2O |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 4-[6-[1-amino-2-(3,5-difluorophenyl)ethyl]-5-bromo-2-pyridinyl]-2-methylbut-3-yn-2-ol;ethane |
| SMILES | CC.CC(C)(O)C#Cc1ccc(Br)c(C(N)Cc2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C18H17BrF2N2O.C2H6/c1-18(2,24)6-5-14-3-4-15(19)17(23-14)16(22)9-11-7-12(20)10-13(21)8-11;1-2/h3-4,7-8,10,16,24H,9,22H2,1-2H3;1-2H3 |
| InChIKey | RUOKGYFZZAYSQY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|