C19H18BrF2N — CID 139425296
3-bromo-2-[2-(3,5-difluorophenyl)ethyl]-6-(3,3-dimethylbut-1-ynyl)pyridine (PubChem CID 139425296) has the molecular formula C19H18BrF2N and a molecular weight of 378.26 g/mol. Its IUPAC name is 3-bromo-2-[2-(3,5-difluorophenyl)ethyl]-6-(3,3-dimethylbut-1-ynyl)pyridine.
| Compound Name | 3-bromo-2-[2-(3,5-difluorophenyl)ethyl]-6-(3,3-dimethylbut-1-ynyl)pyridine |
|---|---|
| PubChem CID | 139425296 |
| Molecular Formula | C19H18BrF2N |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 3-bromo-2-[2-(3,5-difluorophenyl)ethyl]-6-(3,3-dimethylbut-1-ynyl)pyridine |
| SMILES | CC(C)(C)C#Cc1ccc(Br)c(CCc2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C19H18BrF2N/c1-19(2,3)9-8-16-5-6-17(20)18(23-16)7-4-13-10-14(21)12-15(22)11-13/h5-6,10-12H,4,7H2,1-3H3 |
| InChIKey | IVDFKISITWEHEN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|