C22H21BrF2N2O4S — CID 175075921
[1-[3-bromo-6-(3-cyclopropylsulfonyl-3-methylbut-1-ynyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl] carbamate (PubChem CID 175075921) has the molecular formula C22H21BrF2N2O4S and a molecular weight of 527.39 g/mol. Its IUPAC name is [1-[3-bromo-6-(3-cyclopropylsulfonyl-3-methylbut-1-ynyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl] carbamate.
| Compound Name | [1-[3-bromo-6-(3-cyclopropylsulfonyl-3-methylbut-1-ynyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl] carbamate |
|---|---|
| PubChem CID | 175075921 |
| Molecular Formula | C22H21BrF2N2O4S |
| Molecular Weight | 527.39 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | [1-[3-bromo-6-(3-cyclopropylsulfonyl-3-methylbut-1-ynyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl] carbamate |
| SMILES | CC(C)(C#Cc1ccc(Br)c(C(Cc2cc(F)cc(F)c2)OC(N)=O)n1)S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C22H21BrF2N2O4S/c1-22(2,32(29,30)17-4-5-17)8-7-16-3-6-18(23)20(27-16)19(31-21(26)28)11-13-9-14(24)12-15(25)10-13/h3,6,9-10,12,17,19H,4-5,11H2,1-2H3,(H2,26,28) |
| InChIKey | XXJIFWKUGOEGDU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|