C18H18Br2F2N2O2 — CID 90280386
tert-butyl N-(3,6-dibromo-2-pyridinyl)-N-[2-(3,5-difluorophenyl)ethyl]carbamate (PubChem CID 90280386) has the molecular formula C18H18Br2F2N2O2 and a molecular weight of 492.16 g/mol. Its IUPAC name is tert-butyl N-(3,6-dibromo-2-pyridinyl)-N-[2-(3,5-difluorophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-(3,6-dibromo-2-pyridinyl)-N-[2-(3,5-difluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 90280386 |
| Molecular Formula | C18H18Br2F2N2O2 |
| Molecular Weight | 492.16 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | tert-butyl N-(3,6-dibromo-2-pyridinyl)-N-[2-(3,5-difluorophenyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1cc(F)cc(F)c1)c1nc(Br)ccc1Br |
| InChI | InChI=1S/C18H18Br2F2N2O2/c1-18(2,3)26-17(25)24(16-14(19)4-5-15(20)23-16)7-6-11-8-12(21)10-13(22)9-11/h4-5,8-10H,6-7H2,1-3H3 |
| InChIKey | QODUWMJLCSEJBN-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.16 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|