C24H23F2N3O2 — CID 158232083
3-[2-[2-(3,5-difluorophenyl)ethyl]-5-nitrophenyl]-4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazole (PubChem CID 158232083) has the molecular formula C24H23F2N3O2 and a molecular weight of 423.46 g/mol. Its IUPAC name is 3-[2-[2-(3,5-difluorophenyl)ethyl]-5-nitrophenyl]-4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazole.
| Compound Name | 3-[2-[2-(3,5-difluorophenyl)ethyl]-5-nitrophenyl]-4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazole |
|---|---|
| PubChem CID | 158232083 |
| Molecular Formula | C24H23F2N3O2 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-[2-[2-(3,5-difluorophenyl)ethyl]-5-nitrophenyl]-4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazole |
| SMILES | Cn1cc(C#CC(C)(C)C)c(-c2cc([N+](=O)[O-])ccc2CCc2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C24H23F2N3O2/c1-24(2,3)10-9-18-15-28(4)27-23(18)22-14-21(29(30)31)8-7-17(22)6-5-16-11-19(25)13-20(26)12-16/h7-8,11-15H,5-6H2,1-4H3 |
| InChIKey | GEMPBOCSUNICNR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|