C33H44N8O4 — CID 89283886
N,N'-bis[2-(4-tert-butyl-1-methylpyrazol-3-yl)-4-nitrophenyl]-2,2-dimethylpropane-1,3-diamine (PubChem CID 89283886) has the molecular formula C33H44N8O4 and a molecular weight of 616.77 g/mol. Its IUPAC name is N,N'-bis[2-(4-tert-butyl-1-methylpyrazol-3-yl)-4-nitrophenyl]-2,2-dimethylpropane-1,3-diamine.
| Compound Name | N,N'-bis[2-(4-tert-butyl-1-methylpyrazol-3-yl)-4-nitrophenyl]-2,2-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 89283886 |
| Molecular Formula | C33H44N8O4 |
| Molecular Weight | 616.77 g/mol |
| Exact Mass | 616.35 |
| IUPAC Name | N,N'-bis[2-(4-tert-butyl-1-methylpyrazol-3-yl)-4-nitrophenyl]-2,2-dimethylpropane-1,3-diamine |
| SMILES | Cn1cc(C(C)(C)C)c(-c2cc([N+](=O)[O-])ccc2NCC(C)(C)CNc2ccc([N+](=O)[O-])cc2-c2nn(C)cc2C(C)(C)C)n1 |
| InChI | InChI=1S/C33H44N8O4/c1-31(2,3)25-17-38(9)36-29(25)23-15-21(40(42)43)11-13-27(23)34-19-33(7,8)20-35-28-14-12-22(41(44)45)16-24(28)30-26(32(4,5)6)18-39(10)37-30/h11-18,34-35H,19-20H2,1-10H3 |
| InChIKey | JUIFMEIFWWOQFO-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 145.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.77 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|