C23H22F2N4O2 — CID 11718784
N-[(2,6-difluorophenyl)methyl]-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline (PubChem CID 11718784) has the molecular formula C23H22F2N4O2 and a molecular weight of 424.45 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline.
| Compound Name | N-[(2,6-difluorophenyl)methyl]-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline |
|---|---|
| PubChem CID | 11718784 |
| Molecular Formula | C23H22F2N4O2 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline |
| SMILES | Cn1cc(C#CC(C)(C)C)c(-c2cc([N+](=O)[O-])ccc2NCc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C23H22F2N4O2/c1-23(2,3)11-10-15-14-28(4)27-22(15)17-12-16(29(30)31)8-9-21(17)26-13-18-19(24)6-5-7-20(18)25/h5-9,12,14,26H,13H2,1-4H3 |
| InChIKey | YDYSNRDFVIGHJN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|