C25H24FN3O3 — CID 157103615
2-[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitrophenyl]-1-(2-fluoro-5-methylphenyl)ethanone (PubChem CID 157103615) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is 2-[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitrophenyl]-1-(2-fluoro-5-methylphenyl)ethanone.
| Compound Name | 2-[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitrophenyl]-1-(2-fluoro-5-methylphenyl)ethanone |
|---|---|
| PubChem CID | 157103615 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitrophenyl]-1-(2-fluoro-5-methylphenyl)ethanone |
| SMILES | Cc1ccc(F)c(C(=O)Cc2ccc([N+](=O)[O-])cc2-c2nn(C)cc2C#CC(C)(C)C)c1 |
| InChI | InChI=1S/C25H24FN3O3/c1-16-6-9-22(26)21(12-16)23(30)13-17-7-8-19(29(31)32)14-20(17)24-18(15-28(5)27-24)10-11-25(2,3)4/h6-9,12,14-15H,13H2,1-5H3 |
| InChIKey | AGAWBZJNJWCDME-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|