C21H22F2N4O2 — CID 71110815
2-(4-tert-butyl-1-methylpyrazol-3-yl)-N-[(2,6-difluorophenyl)methyl]-4-nitroaniline (PubChem CID 71110815) has the molecular formula C21H22F2N4O2 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-(4-tert-butyl-1-methylpyrazol-3-yl)-N-[(2,6-difluorophenyl)methyl]-4-nitroaniline.
| Compound Name | 2-(4-tert-butyl-1-methylpyrazol-3-yl)-N-[(2,6-difluorophenyl)methyl]-4-nitroaniline |
|---|---|
| PubChem CID | 71110815 |
| Molecular Formula | C21H22F2N4O2 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-(4-tert-butyl-1-methylpyrazol-3-yl)-N-[(2,6-difluorophenyl)methyl]-4-nitroaniline |
| SMILES | Cn1cc(C(C)(C)C)c(-c2cc([N+](=O)[O-])ccc2NCc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C21H22F2N4O2/c1-21(2,3)16-12-26(4)25-20(16)14-10-13(27(28)29)8-9-19(14)24-11-15-17(22)6-5-7-18(15)23/h5-10,12,24H,11H2,1-4H3 |
| InChIKey | GSYLCTUMEWVXBP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|