C13H10Br2F2N2 — CID 123767101
1-(3,6-dibromo-2-pyridinyl)-2-(3,5-difluorophenyl)ethanamine (PubChem CID 123767101) has the molecular formula C13H10Br2F2N2 and a molecular weight of 392.04 g/mol. Its IUPAC name is 1-(3,6-dibromo-2-pyridinyl)-2-(3,5-difluorophenyl)ethanamine.
| Compound Name | 1-(3,6-dibromo-2-pyridinyl)-2-(3,5-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 123767101 |
| Molecular Formula | C13H10Br2F2N2 |
| Molecular Weight | 392.04 g/mol |
| Exact Mass | 389.92 |
| IUPAC Name | 1-(3,6-dibromo-2-pyridinyl)-2-(3,5-difluorophenyl)ethanamine |
| SMILES | NC(Cc1cc(F)cc(F)c1)c1nc(Br)ccc1Br |
| InChI | InChI=1S/C13H10Br2F2N2/c14-10-1-2-12(15)19-13(10)11(18)5-7-3-8(16)6-9(17)4-7/h1-4,6,11H,5,18H2 |
| InChIKey | QTZBWPGHYZUOES-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.04 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|