C13H8Br2F2N4 — CID 151913651
2-[1-azido-2-(3,5-difluorophenyl)ethyl]-3,6-dibromopyridine (PubChem CID 151913651) has the molecular formula C13H8Br2F2N4 and a molecular weight of 418.04 g/mol. Its IUPAC name is 2-[1-azido-2-(3,5-difluorophenyl)ethyl]-3,6-dibromopyridine.
| Compound Name | 2-[1-azido-2-(3,5-difluorophenyl)ethyl]-3,6-dibromopyridine |
|---|---|
| PubChem CID | 151913651 |
| Molecular Formula | C13H8Br2F2N4 |
| Molecular Weight | 418.04 g/mol |
| Exact Mass | 415.91 |
| IUPAC Name | 2-[1-azido-2-(3,5-difluorophenyl)ethyl]-3,6-dibromopyridine |
| SMILES | [N-]=[N+]=NC(Cc1cc(F)cc(F)c1)c1nc(Br)ccc1Br |
| InChI | InChI=1S/C13H8Br2F2N4/c14-10-1-2-12(15)19-13(10)11(20-21-18)5-7-3-8(16)6-9(17)4-7/h1-4,6,11H,5H2 |
| InChIKey | SVHRZFRHGKGIQD-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.04 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|