C18H17BrF2N2 — CID 151118445
(1S)-1-[3-bromo-5-(3-methylbut-1-ynyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethanamine (PubChem CID 151118445) has the molecular formula C18H17BrF2N2 and a molecular weight of 379.25 g/mol. Its IUPAC name is (1S)-1-[3-bromo-5-(3-methylbut-1-ynyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethanamine.
| Compound Name | (1S)-1-[3-bromo-5-(3-methylbut-1-ynyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 151118445 |
| Molecular Formula | C18H17BrF2N2 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | (1S)-1-[3-bromo-5-(3-methylbut-1-ynyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethanamine |
| SMILES | CC(C)C#Cc1cnc([C@@H](N)Cc2cc(F)cc(F)c2)c(Br)c1 |
| InChI | InChI=1S/C18H17BrF2N2/c1-11(2)3-4-12-7-16(19)18(23-10-12)17(22)8-13-5-14(20)9-15(21)6-13/h5-7,9-11,17H,8,22H2,1-2H3/t17-/m0/s1 |
| InChIKey | MRRBRTMVCGNKFH-KRWDZBQOSA-N |
| XLogP | 4.37 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|