C19H21BN3O+ — CID 158054483
4-(1,4-dimethylpyridin-1-ium-2-yl)-3,5-dimethyl-11-(trideuteriomethyl)-8-oxa-5,10-diaza-4-boratricyclo[7.4.0.02,7]trideca-1(9),2,6,10,12-pentaene (PubChem CID 158054483) has the molecular formula C19H21BN3O+ and a molecular weight of 321.23 g/mol. Its IUPAC name is 4-(1,4-dimethylpyridin-1-ium-2-yl)-3,5-dimethyl-11-(trideuteriomethyl)-8-oxa-5,10-diaza-4-boratricyclo[7.4.0.02,7]trideca-1(9),2,6,10,12-pentaene.
| Compound Name | 4-(1,4-dimethylpyridin-1-ium-2-yl)-3,5-dimethyl-11-(trideuteriomethyl)-8-oxa-5,10-diaza-4-boratricyclo[7.4.0.02,7]trideca-1(9),2,6,10,12-pentaene |
|---|---|
| PubChem CID | 158054483 |
| Molecular Formula | C19H21BN3O+ |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 4-(1,4-dimethylpyridin-1-ium-2-yl)-3,5-dimethyl-11-(trideuteriomethyl)-8-oxa-5,10-diaza-4-boratricyclo[7.4.0.02,7]trideca-1(9),2,6,10,12-pentaene |
| SMILES | [2H]C([2H])([2H])c1ccc2c3c(oc2n1)=CN(C)B(c1cc(C)cc[n+]1C)C=3C |
| InChI | InChI=1S/C19H21BN3O/c1-12-8-9-22(4)17(10-12)20-14(3)18-15-7-6-13(2)21-19(15)24-16(18)11-23(20)5/h6-11H,1-5H3/q+1/i2D3 |
| InChIKey | DAAWQFRSCKJHIT-BMSJAHLVSA-N |
| XLogP | 0.56 |
| TPSA | 33.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|