C19H21BN3O+ — CID 159560978
6-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-5-methyl-3-(trideuteriomethyl)-8-oxa-5,10-diaza-6-boratricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene (PubChem CID 159560978) has the molecular formula C19H21BN3O+ and a molecular weight of 324.25 g/mol. Its IUPAC name is 6-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-5-methyl-3-(trideuteriomethyl)-8-oxa-5,10-diaza-6-boratricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene.
| Compound Name | 6-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-5-methyl-3-(trideuteriomethyl)-8-oxa-5,10-diaza-6-boratricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene |
|---|---|
| PubChem CID | 159560978 |
| Molecular Formula | C19H21BN3O+ |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 6-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-5-methyl-3-(trideuteriomethyl)-8-oxa-5,10-diaza-6-boratricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene |
| SMILES | [2H]C([2H])([2H])C1=CN(C)B(c2cc(C)c(C([2H])([2H])[2H])c[n+]2C)c2oc3ncccc3c21 |
| InChI | InChI=1S/C19H21BN3O/c1-12-9-16(22(4)10-13(12)2)20-18-17(14(3)11-23(20)5)15-7-6-8-21-19(15)24-18/h6-11H,1-5H3/q+1/i2D3,3D3 |
| InChIKey | SRNSCNDRBOMVOV-XERRXZQWSA-N |
| XLogP | 1.68 |
| TPSA | 33.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|