C19H20BN2O+ — CID 158814343
2,4-dimethyl-3-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-d]azaborinine (PubChem CID 158814343) has the molecular formula C19H20BN2O+ and a molecular weight of 306.21 g/mol. Its IUPAC name is 2,4-dimethyl-3-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-d]azaborinine.
| Compound Name | 2,4-dimethyl-3-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-d]azaborinine |
|---|---|
| PubChem CID | 158814343 |
| Molecular Formula | C19H20BN2O+ |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2,4-dimethyl-3-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-d]azaborinine |
| SMILES | [2H]C([2H])([2H])c1ccc(B2C(C)=c3oc4ccccc4c3=CN2C)[n+](C)c1 |
| InChI | InChI=1S/C19H20BN2O/c1-13-9-10-18(21(3)11-13)20-14(2)19-16(12-22(20)4)15-7-5-6-8-17(15)23-19/h5-12H,1-4H3/q+1/i1D3 |
| InChIKey | RDBFAPBPMFHQEK-FIBGUPNXSA-N |
| XLogP | 0.86 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|