C10H15Cl3N2 — CID 158056719
1,1-bis(2-chloroethyl)-2-phenylhydrazine;hydrochloride (PubChem CID 158056719) has the molecular formula C10H15Cl3N2 and a molecular weight of 269.60 g/mol. Its IUPAC name is 1,1-bis(2-chloroethyl)-2-phenylhydrazine;hydrochloride.
| Compound Name | 1,1-bis(2-chloroethyl)-2-phenylhydrazine;hydrochloride |
|---|---|
| PubChem CID | 158056719 |
| Molecular Formula | C10H15Cl3N2 |
| Molecular Weight | 269.60 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 1,1-bis(2-chloroethyl)-2-phenylhydrazine;hydrochloride |
| SMILES | Cl.ClCCN(CCCl)Nc1ccccc1 |
| InChI | InChI=1S/C10H14Cl2N2.ClH/c11-6-8-14(9-7-12)13-10-4-2-1-3-5-10;/h1-5,13H,6-9H2;1H |
| InChIKey | RBIIFPDXCIMCCQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|