C12H21N4W- — CID 158057474
ethane;3-piperazin-4-id-1-ylbenzene-1,2-diamine;tungsten (PubChem CID 158057474) has the molecular formula C12H21N4W- and a molecular weight of 405.17 g/mol. Its IUPAC name is ethane;3-piperazin-4-id-1-ylbenzene-1,2-diamine;tungsten.
| Compound Name | ethane;3-piperazin-4-id-1-ylbenzene-1,2-diamine;tungsten |
|---|---|
| PubChem CID | 158057474 |
| Molecular Formula | C12H21N4W- |
| Molecular Weight | 405.17 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | ethane;3-piperazin-4-id-1-ylbenzene-1,2-diamine;tungsten |
| SMILES | CC.Nc1cccc(N2CC[N-]CC2)c1N.[W] |
| InChI | InChI=1S/C10H15N4.C2H6.W/c11-8-2-1-3-9(10(8)12)14-6-4-13-5-7-14;1-2;/h1-3H,4-7,11-12H2;1-2H3;/q-1;; |
| InChIKey | XAGKANXCRWTIAE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|