C13H19N5 — CID 156708225
3-[4-(2-isocyanoethyl)piperazin-1-yl]benzene-1,2-diamine (PubChem CID 156708225) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-[4-(2-isocyanoethyl)piperazin-1-yl]benzene-1,2-diamine.
| Compound Name | 3-[4-(2-isocyanoethyl)piperazin-1-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 156708225 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 3-[4-(2-isocyanoethyl)piperazin-1-yl]benzene-1,2-diamine |
| SMILES | [C-]#[N+]CCN1CCN(c2cccc(N)c2N)CC1 |
| InChI | InChI=1S/C13H19N5/c1-16-5-6-17-7-9-18(10-8-17)12-4-2-3-11(14)13(12)15/h2-4H,5-10,14-15H2 |
| InChIKey | CVZMPSMTGUIRLG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|