C13H18F3N3 — CID 67533765
2-(4-ethylpiperazin-1-yl)-6-(trifluoromethyl)aniline (PubChem CID 67533765) has the molecular formula C13H18F3N3 and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-6-(trifluoromethyl)aniline.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 67533765 |
| Molecular Formula | C13H18F3N3 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-6-(trifluoromethyl)aniline |
| SMILES | CCN1CCN(c2cccc(C(F)(F)F)c2N)CC1 |
| InChI | InChI=1S/C13H18F3N3/c1-2-18-6-8-19(9-7-18)11-5-3-4-10(12(11)17)13(14,15)16/h3-5H,2,6-9,17H2,1H3 |
| InChIKey | BWIPZQANMOIMBZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|