C12H15ClF3N3 — CID 104834492
2-chloro-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]aniline (PubChem CID 104834492) has the molecular formula C12H15ClF3N3 and a molecular weight of 293.72 g/mol. Its IUPAC name is 2-chloro-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]aniline.
| Compound Name | 2-chloro-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]aniline |
|---|---|
| PubChem CID | 104834492 |
| Molecular Formula | C12H15ClF3N3 |
| Molecular Weight | 293.72 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-chloro-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]aniline |
| SMILES | Nc1c(Cl)cccc1N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H15ClF3N3/c13-9-2-1-3-10(11(9)17)19-6-4-18(5-7-19)8-12(14,15)16/h1-3H,4-8,17H2 |
| InChIKey | GSWLOAMXYHCWRE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.72 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|