C13H16F3N3S — CID 62966714
2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenecarbothioamide (PubChem CID 62966714) has the molecular formula C13H16F3N3S and a molecular weight of 303.35 g/mol. Its IUPAC name is 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenecarbothioamide.
| Compound Name | 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 62966714 |
| Molecular Formula | C13H16F3N3S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccccc1N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H16F3N3S/c14-13(15,16)9-18-5-7-19(8-6-18)11-4-2-1-3-10(11)12(17)20/h1-4H,5-9H2,(H2,17,20) |
| InChIKey | CCGLZNRLJPJCLY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|