C20H19Cl3F3N3O2 — CID 158058637
N'-[(1E,3Z)-4-chloro-1-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]hexa-1,3,5-trien-3-yl]butanehydrazide (PubChem CID 158058637) has the molecular formula C20H19Cl3F3N3O2 and a molecular weight of 496.74 g/mol. Its IUPAC name is N'-[(1E,3Z)-4-chloro-1-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]hexa-1,3,5-trien-3-yl]butanehydrazide.
| Compound Name | N'-[(1E,3Z)-4-chloro-1-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]hexa-1,3,5-trien-3-yl]butanehydrazide |
|---|---|
| PubChem CID | 158058637 |
| Molecular Formula | C20H19Cl3F3N3O2 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | N'-[(1E,3Z)-4-chloro-1-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]hexa-1,3,5-trien-3-yl]butanehydrazide |
| SMILES | C=C/C(Cl)=C(\C=C\C1=NOC(c2cc(Cl)cc(Cl)c2)(C(F)(F)F)C1)NNC(=O)CCC |
| InChI | InChI=1S/C20H19Cl3F3N3O2/c1-3-5-18(30)28-27-17(16(23)4-2)7-6-15-11-19(31-29-15,20(24,25)26)12-8-13(21)10-14(22)9-12/h4,6-10,27H,2-3,5,11H2,1H3,(H,28,30)/b7-6+,17-16- |
| InChIKey | FKJJVDVRVNFFNW-NGLZPYLXSA-N |
| XLogP | 6.14 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|