C22H36O8S2 — CID 158061006
4-(2-methyl-5-oxohexan-2-yl)sulfanyl-4-oxobutanoic acid;5-methyl-5-sulfanylhexan-2-one;oxolane-2,5-dione (PubChem CID 158061006) has the molecular formula C22H36O8S2 and a molecular weight of 492.66 g/mol. Its IUPAC name is 4-(2-methyl-5-oxohexan-2-yl)sulfanyl-4-oxobutanoic acid;5-methyl-5-sulfanylhexan-2-one;oxolane-2,5-dione.
| Compound Name | 4-(2-methyl-5-oxohexan-2-yl)sulfanyl-4-oxobutanoic acid;5-methyl-5-sulfanylhexan-2-one;oxolane-2,5-dione |
|---|---|
| PubChem CID | 158061006 |
| Molecular Formula | C22H36O8S2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 4-(2-methyl-5-oxohexan-2-yl)sulfanyl-4-oxobutanoic acid;5-methyl-5-sulfanylhexan-2-one;oxolane-2,5-dione |
| SMILES | CC(=O)CCC(C)(C)S.CC(=O)CCC(C)(C)SC(=O)CCC(=O)O.O=C1CCC(=O)O1 |
| InChI | InChI=1S/C11H18O4S.C7H14OS.C4H4O3/c1-8(12)6-7-11(2,3)16-10(15)5-4-9(13)14;1-6(8)4-5-7(2,3)9;5-3-1-2-4(6)7-3/h4-7H2,1-3H3,(H,13,14);9H,4-5H2,1-3H3;1-2H2 |
| InChIKey | FKQIBLUACLFXTH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|