C23H43NO8 — CID 162066347
oxolane-2,5-dione;4-oxo-9-propan-2-yloxynonanoic acid;4-propan-2-yloxybutan-1-amine (PubChem CID 162066347) has the molecular formula C23H43NO8 and a molecular weight of 461.60 g/mol. Its IUPAC name is oxolane-2,5-dione;4-oxo-9-propan-2-yloxynonanoic acid;4-propan-2-yloxybutan-1-amine.
| Compound Name | oxolane-2,5-dione;4-oxo-9-propan-2-yloxynonanoic acid;4-propan-2-yloxybutan-1-amine |
|---|---|
| PubChem CID | 162066347 |
| Molecular Formula | C23H43NO8 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | oxolane-2,5-dione;4-oxo-9-propan-2-yloxynonanoic acid;4-propan-2-yloxybutan-1-amine |
| SMILES | CC(C)OCCCCCC(=O)CCC(=O)O.CC(C)OCCCCN.O=C1CCC(=O)O1 |
| InChI | InChI=1S/C12H22O4.C7H17NO.C4H4O3/c1-10(2)16-9-5-3-4-6-11(13)7-8-12(14)15;1-7(2)9-6-4-3-5-8;5-3-1-2-4(6)7-3/h10H,3-9H2,1-2H3,(H,14,15);7H,3-6,8H2,1-2H3;1-2H2 |
| InChIKey | ZAMUOXVJYYROBA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|