C27H41N5O2Si — CID 158061393
2-[[6-[1-[3-[(2,6-dimethyl-4-pyridinyl)oxy]piperidin-1-yl]ethyl]-2-methylimidazo[4,5-b]pyridin-3-yl]methoxy]ethyl-trimethylsilane (PubChem CID 158061393) has the molecular formula C27H41N5O2Si and a molecular weight of 495.74 g/mol. Its IUPAC name is 2-[[6-[1-[3-[(2,6-dimethyl-4-pyridinyl)oxy]piperidin-1-yl]ethyl]-2-methylimidazo[4,5-b]pyridin-3-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-[1-[3-[(2,6-dimethyl-4-pyridinyl)oxy]piperidin-1-yl]ethyl]-2-methylimidazo[4,5-b]pyridin-3-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 158061393 |
| Molecular Formula | C27H41N5O2Si |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | 2-[[6-[1-[3-[(2,6-dimethyl-4-pyridinyl)oxy]piperidin-1-yl]ethyl]-2-methylimidazo[4,5-b]pyridin-3-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc(OC2CCCN(C(C)c3cnc4c(c3)nc(C)n4COCC[Si](C)(C)C)C2)cc(C)n1 |
| InChI | InChI=1S/C27H41N5O2Si/c1-19-13-25(14-20(2)29-19)34-24-9-8-10-31(17-24)21(3)23-15-26-27(28-16-23)32(22(4)30-26)18-33-11-12-35(5,6)7/h13-16,21,24H,8-12,17-18H2,1-7H3 |
| InChIKey | FKRSLWQQUTWTKQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|