C12H24F6O2S — CID 158061482
2,2-dimethylpropane;1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;methylsulfonylmethane (PubChem CID 158061482) has the molecular formula C12H24F6O2S and a molecular weight of 346.38 g/mol. Its IUPAC name is 2,2-dimethylpropane;1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;methylsulfonylmethane.
| Compound Name | 2,2-dimethylpropane;1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;methylsulfonylmethane |
|---|---|
| PubChem CID | 158061482 |
| Molecular Formula | C12H24F6O2S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2,2-dimethylpropane;1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;methylsulfonylmethane |
| SMILES | CC(C)(C(F)(F)F)C(F)(F)F.CC(C)(C)C.CS(C)(=O)=O |
| InChI | InChI=1S/C5H6F6.C5H12.C2H6O2S/c1-3(2,4(6,7)8)5(9,10)11;2*1-5(2,3)4/h1-2H3;1-4H3;1-2H3 |
| InChIKey | FKRZVRDJAIVNIN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |