C11H22F6 — CID 158771443
2,2-dimethylpropane;1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;methane (PubChem CID 158771443) has the molecular formula C11H22F6 and a molecular weight of 268.28 g/mol. Its IUPAC name is 2,2-dimethylpropane;1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;methane.
| Compound Name | 2,2-dimethylpropane;1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;methane |
|---|---|
| PubChem CID | 158771443 |
| Molecular Formula | C11H22F6 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2,2-dimethylpropane;1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;methane |
| SMILES | C.CC(C)(C(F)(F)F)C(F)(F)F.CC(C)(C)C |
| InChI | InChI=1S/C5H6F6.C5H12.CH4/c1-3(2,4(6,7)8)5(9,10)11;1-5(2,3)4;/h1-2H3;1-4H3;1H4 |
| InChIKey | IPXMYHCHXAEJQB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |