About cyclohexyl(trimethyl)azanium;fluoroform
cyclohexyl(trimethyl)azanium;fluoroform (PubChem CID 158064313) has the molecular formula C11H22F6N+
and a molecular weight of 282.29 g/mol. Its IUPAC name is cyclohexyl(trimethyl)azanium;fluoroform.
Molecular Properties
| Compound Name | cyclohexyl(trimethyl)azanium;fluoroform |
| PubChem CID | 158064313 |
| Molecular Formula | C11H22F6N+ |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | cyclohexyl(trimethyl)azanium;fluoroform |
| SMILES | C[N+](C)(C)C1CCCCC1.FC(F)F.FC(F)F |
| InChI | InChI=1S/C9H20N.2CHF3/c1-10(2,3)9-7-5-4-6-8-9;2*2-1(3)4/h9H,4-8H2,1-3H3;2*1H/q+1;; |
| InChIKey | FLAOEQPKHSUTCM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl(trimethyl)azanium;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl(trimethyl)azanium;fluoroform?
The IUPAC name of cyclohexyl(trimethyl)azanium;fluoroform (CID 158064313) is cyclohexyl(trimethyl)azanium;fluoroform.
What is the SMILES notation for cyclohexyl(trimethyl)azanium;fluoroform?
The canonical SMILES for cyclohexyl(trimethyl)azanium;fluoroform is C[N+](C)(C)C1CCCCC1.FC(F)F.FC(F)F.
What is the InChIKey of cyclohexyl(trimethyl)azanium;fluoroform?
The InChIKey is FLAOEQPKHSUTCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N.2CHF3/c1-10(2,3)9-7-5-4-6-8-9;2*2-1(3)4/h9H,4-8H2,1-3H3;2*1H/q+1;;.
What are the key properties of cyclohexyl(trimethyl)azanium;fluoroform?
cyclohexyl(trimethyl)azanium;fluoroform has a molecular weight of 282.29 g/mol, XLogP of 4.38, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl(trimethyl)azanium;fluoroform is sourced from PubChem (CID 158064313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).