cyclohexyl(trimethyl)azanium nitrate

C9H20N2O3 — CID 15953491

IUPACcyclohexyl(trimethyl)azanium nitrate
SMILESC[N+](C)(C)C1CCCCC1.O=[N+]([O-])[O-]
InChIInChI=1S/C9H20N.NO3/c1-10(2,3)9-7-5-4-6-8-9;2-1(3)4/h9H,4-8H2,1-3H3;/q+1;-1
InChIKeyWODFFUCMTRBSLC-UHFFFAOYSA-N
MW204.27 g/mol
LogP1.79
Rot. Bonds1

About cyclohexyl(trimethyl)azanium nitrate

cyclohexyl(trimethyl)azanium nitrate (PubChem CID 15953491) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is cyclohexyl(trimethyl)azanium nitrate.

Molecular Properties

Compound Namecyclohexyl(trimethyl)azanium nitrate
PubChem CID15953491
Molecular FormulaC9H20N2O3
Molecular Weight204.27 g/mol
Exact Mass204.15
IUPAC Namecyclohexyl(trimethyl)azanium nitrate
SMILESC[N+](C)(C)C1CCCCC1.O=[N+]([O-])[O-]
InChIInChI=1S/C9H20N.NO3/c1-10(2,3)9-7-5-4-6-8-9;2-1(3)4/h9H,4-8H2,1-3H3;/q+1;-1
InChIKeyWODFFUCMTRBSLC-UHFFFAOYSA-N
XLogP1.79
TPSA66.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.27
LogP ≤ 51.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze cyclohexyl(trimethyl)azanium nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclohexyl(trimethyl)azanium nitrate?
The IUPAC name of cyclohexyl(trimethyl)azanium nitrate (CID 15953491) is cyclohexyl(trimethyl)azanium nitrate.
What is the SMILES notation for cyclohexyl(trimethyl)azanium nitrate?
The canonical SMILES for cyclohexyl(trimethyl)azanium nitrate is C[N+](C)(C)C1CCCCC1.O=[N+]([O-])[O-].
What is the InChIKey of cyclohexyl(trimethyl)azanium nitrate?
The InChIKey is WODFFUCMTRBSLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N.NO3/c1-10(2,3)9-7-5-4-6-8-9;2-1(3)4/h9H,4-8H2,1-3H3;/q+1;-1.
What are the key properties of cyclohexyl(trimethyl)azanium nitrate?
cyclohexyl(trimethyl)azanium nitrate has a molecular weight of 204.27 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl(trimethyl)azanium nitrate is sourced from PubChem (CID 15953491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).