C26H28ClN5O3 — CID 158065322
N-[7-chloro-5-(2-oxopropyl)-1-(1-prop-2-enoylazepan-3-yl)benzimidazol-2-yl]-2-methylpyridine-4-carboxamide (PubChem CID 158065322) has the molecular formula C26H28ClN5O3 and a molecular weight of 494.00 g/mol. Its IUPAC name is N-[7-chloro-5-(2-oxopropyl)-1-(1-prop-2-enoylazepan-3-yl)benzimidazol-2-yl]-2-methylpyridine-4-carboxamide.
| Compound Name | N-[7-chloro-5-(2-oxopropyl)-1-(1-prop-2-enoylazepan-3-yl)benzimidazol-2-yl]-2-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 158065322 |
| Molecular Formula | C26H28ClN5O3 |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | N-[7-chloro-5-(2-oxopropyl)-1-(1-prop-2-enoylazepan-3-yl)benzimidazol-2-yl]-2-methylpyridine-4-carboxamide |
| SMILES | C=CC(=O)N1CCCCC(n2c(NC(=O)c3ccnc(C)c3)nc3cc(CC(C)=O)cc(Cl)c32)C1 |
| InChI | InChI=1S/C26H28ClN5O3/c1-4-23(34)31-10-6-5-7-20(15-31)32-24-21(27)13-18(12-17(3)33)14-22(24)29-26(32)30-25(35)19-8-9-28-16(2)11-19/h4,8-9,11,13-14,20H,1,5-7,10,12,15H2,2-3H3,(H,29,30,35) |
| InChIKey | FLDOTVDIAROTNN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|