C28H32ClN5O4 — CID 154032220
N-[7-chloro-5-(oxan-4-yloxy)-1-[(3S)-1-prop-2-enoylazepan-3-yl]benzimidazol-2-yl]-2-methylpyridine-4-carboxamide (PubChem CID 154032220) has the molecular formula C28H32ClN5O4 and a molecular weight of 538.05 g/mol. Its IUPAC name is N-[7-chloro-5-(oxan-4-yloxy)-1-[(3S)-1-prop-2-enoylazepan-3-yl]benzimidazol-2-yl]-2-methylpyridine-4-carboxamide.
| Compound Name | N-[7-chloro-5-(oxan-4-yloxy)-1-[(3S)-1-prop-2-enoylazepan-3-yl]benzimidazol-2-yl]-2-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 154032220 |
| Molecular Formula | C28H32ClN5O4 |
| Molecular Weight | 538.05 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | N-[7-chloro-5-(oxan-4-yloxy)-1-[(3S)-1-prop-2-enoylazepan-3-yl]benzimidazol-2-yl]-2-methylpyridine-4-carboxamide |
| SMILES | C=CC(=O)N1CCCC[C@H](n2c(NC(=O)c3ccnc(C)c3)nc3cc(OC4CCOCC4)cc(Cl)c32)C1 |
| InChI | InChI=1S/C28H32ClN5O4/c1-3-25(35)33-11-5-4-6-20(17-33)34-26-23(29)15-22(38-21-8-12-37-13-9-21)16-24(26)31-28(34)32-27(36)19-7-10-30-18(2)14-19/h3,7,10,14-16,20-21H,1,4-6,8-9,11-13,17H2,2H3,(H,31,32,36)/t20-/m0/s1 |
| InChIKey | IBCQDRZFIQTYSM-FQEVSTJZSA-N |
| XLogP | 4.94 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.05 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|