C28H31ClN5O4- — CID 144927442
(4Z)-N-[7-chloro-6-(oxan-4-yloxy)-1-[(3R)-1-prop-2-enoylazepan-3-yl]benzimidazol-2-yl]-2-methylpyridine-4-carboximidate (PubChem CID 144927442) has the molecular formula C28H31ClN5O4- and a molecular weight of 537.04 g/mol. Its IUPAC name is (4Z)-N-[7-chloro-6-(oxan-4-yloxy)-1-[(3R)-1-prop-2-enoylazepan-3-yl]benzimidazol-2-yl]-2-methylpyridine-4-carboximidate.
| Compound Name | (4Z)-N-[7-chloro-6-(oxan-4-yloxy)-1-[(3R)-1-prop-2-enoylazepan-3-yl]benzimidazol-2-yl]-2-methylpyridine-4-carboximidate |
|---|---|
| PubChem CID | 144927442 |
| Molecular Formula | C28H31ClN5O4- |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | (4Z)-N-[7-chloro-6-(oxan-4-yloxy)-1-[(3R)-1-prop-2-enoylazepan-3-yl]benzimidazol-2-yl]-2-methylpyridine-4-carboximidate |
| SMILES | C=CC(=O)N1CCCC[C@@H](n2c(/N=C(\[O-])c3ccnc(C)c3)nc3ccc(OC4CCOCC4)c(Cl)c32)C1 |
| InChI | InChI=1S/C28H32ClN5O4/c1-3-24(35)33-13-5-4-6-20(17-33)34-26-22(7-8-23(25(26)29)38-21-10-14-37-15-11-21)31-28(34)32-27(36)19-9-12-30-18(2)16-19/h3,7-9,12,16,20-21H,1,4-6,10-11,13-15,17H2,2H3,(H,31,32,36)/p-1/t20-/m1/s1 |
| InChIKey | RCSHISLZAHPAOI-HXUWFJFHSA-M |
| XLogP | 4.13 |
| TPSA | 104.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|