C27H28ClF2N5O4 — CID 144927400
N-[7-chloro-6-(oxolan-3-yloxy)-1-(1-prop-2-enoylazepan-3-yl)benzimidazol-2-yl]-2-(difluoromethyl)pyridine-4-carboxamide (PubChem CID 144927400) has the molecular formula C27H28ClF2N5O4 and a molecular weight of 560.00 g/mol. Its IUPAC name is N-[7-chloro-6-(oxolan-3-yloxy)-1-(1-prop-2-enoylazepan-3-yl)benzimidazol-2-yl]-2-(difluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-[7-chloro-6-(oxolan-3-yloxy)-1-(1-prop-2-enoylazepan-3-yl)benzimidazol-2-yl]-2-(difluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 144927400 |
| Molecular Formula | C27H28ClF2N5O4 |
| Molecular Weight | 560.00 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | N-[7-chloro-6-(oxolan-3-yloxy)-1-(1-prop-2-enoylazepan-3-yl)benzimidazol-2-yl]-2-(difluoromethyl)pyridine-4-carboxamide |
| SMILES | C=CC(=O)N1CCCCC(n2c(NC(=O)c3ccnc(C(F)F)c3)nc3ccc(OC4CCOC4)c(Cl)c32)C1 |
| InChI | InChI=1S/C27H28ClF2N5O4/c1-2-22(36)34-11-4-3-5-17(14-34)35-24-19(6-7-21(23(24)28)39-18-9-12-38-15-18)32-27(35)33-26(37)16-8-10-31-20(13-16)25(29)30/h2,6-8,10,13,17-18,25H,1,3-5,9,11-12,14-15H2,(H,32,33,37) |
| InChIKey | XYYQNYVLTGTGPR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.00 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|