C28H33N5O4 — CID 123194949
2-methyl-N-[7-(oxan-4-yloxy)-1-(1-prop-2-enoylazepan-3-yl)benzimidazol-2-yl]pyridine-4-carboxamide (PubChem CID 123194949) has the molecular formula C28H33N5O4 and a molecular weight of 503.60 g/mol. Its IUPAC name is 2-methyl-N-[7-(oxan-4-yloxy)-1-(1-prop-2-enoylazepan-3-yl)benzimidazol-2-yl]pyridine-4-carboxamide.
| Compound Name | 2-methyl-N-[7-(oxan-4-yloxy)-1-(1-prop-2-enoylazepan-3-yl)benzimidazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 123194949 |
| Molecular Formula | C28H33N5O4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 2-methyl-N-[7-(oxan-4-yloxy)-1-(1-prop-2-enoylazepan-3-yl)benzimidazol-2-yl]pyridine-4-carboxamide |
| SMILES | C=CC(=O)N1CCCCC(n2c(NC(=O)c3ccnc(C)c3)nc3cccc(OC4CCOCC4)c32)C1 |
| InChI | InChI=1S/C28H33N5O4/c1-3-25(34)32-14-5-4-7-21(18-32)33-26-23(8-6-9-24(26)37-22-11-15-36-16-12-22)30-28(33)31-27(35)20-10-13-29-19(2)17-20/h3,6,8-10,13,17,21-22H,1,4-5,7,11-12,14-16,18H2,2H3,(H,30,31,35) |
| InChIKey | GHSRDAAXXKCGKK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|