C25H36ClN5O4S — CID 158069943
(1R,2S,3R,5S)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2-propan-2-yloxyethylamino)pyrimidin-4-yl]amino]-5-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol;hydrochloride (PubChem CID 158069943) has the molecular formula C25H36ClN5O4S and a molecular weight of 538.11 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2-propan-2-yloxyethylamino)pyrimidin-4-yl]amino]-5-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol;hydrochloride.
| Compound Name | (1R,2S,3R,5S)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2-propan-2-yloxyethylamino)pyrimidin-4-yl]amino]-5-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 158069943 |
| Molecular Formula | C25H36ClN5O4S |
| Molecular Weight | 538.11 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | (1R,2S,3R,5S)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2-propan-2-yloxyethylamino)pyrimidin-4-yl]amino]-5-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol;hydrochloride |
| SMILES | Cc1nc(NCCOC(C)C)nc(N[C@@H]2C[C@H](C(C)(C)O)[C@@H](O)[C@H]2O)c1-c1nc2ccccc2s1.Cl |
| InChI | InChI=1S/C25H35N5O4S.ClH/c1-13(2)34-11-10-26-24-27-14(3)19(23-29-16-8-6-7-9-18(16)35-23)22(30-24)28-17-12-15(25(4,5)33)20(31)21(17)32;/h6-9,13,15,17,20-21,31-33H,10-12H2,1-5H3,(H2,26,27,28,30);1H/t15-,17+,20+,21-;/m0./s1 |
| InChIKey | HTWYQSIKNHAWTG-FWPZIOSXSA-N |
| XLogP | 3.61 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.11 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|