C27H41NO3 — CID 158069972
(3S,7R)-10-hydroxy-3,7,22-trimethyl-19-oxa-20-azahexacyclo[18.4.2.02,18.03,16.06,15.07,12]hexacos-12-en-26-one (PubChem CID 158069972) has the molecular formula C27H41NO3 and a molecular weight of 427.63 g/mol. Its IUPAC name is (3S,7R)-10-hydroxy-3,7,22-trimethyl-19-oxa-20-azahexacyclo[18.4.2.02,18.03,16.06,15.07,12]hexacos-12-en-26-one.
| Compound Name | (3S,7R)-10-hydroxy-3,7,22-trimethyl-19-oxa-20-azahexacyclo[18.4.2.02,18.03,16.06,15.07,12]hexacos-12-en-26-one |
|---|---|
| PubChem CID | 158069972 |
| Molecular Formula | C27H41NO3 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | (3S,7R)-10-hydroxy-3,7,22-trimethyl-19-oxa-20-azahexacyclo[18.4.2.02,18.03,16.06,15.07,12]hexacos-12-en-26-one |
| SMILES | CC1CCC2CC(=O)N(C1)OC1CC3C4CC=C5CC(O)CC[C@]5(C)C4CC[C@]3(C)C21 |
| InChI | InChI=1S/C27H41NO3/c1-16-4-5-17-12-24(30)28(15-16)31-23-14-22-20-7-6-18-13-19(29)8-10-26(18,2)21(20)9-11-27(22,3)25(17)23/h6,16-17,19-23,25,29H,4-5,7-15H2,1-3H3/t16?,17?,19?,20?,21?,22?,23?,25?,26-,27-/m0/s1 |
| InChIKey | FLSAZLGPKAPHOH-UZQICLFLSA-N |
| XLogP | 5.11 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|