C22H26INO5 — CID 158075429
2-[4-(hydroxymethyl)-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-1-(2-methoxyphenyl)ethanone iodide (PubChem CID 158075429) has the molecular formula C22H26INO5 and a molecular weight of 511.36 g/mol. Its IUPAC name is 2-[4-(hydroxymethyl)-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-1-(2-methoxyphenyl)ethanone iodide.
| Compound Name | 2-[4-(hydroxymethyl)-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-1-(2-methoxyphenyl)ethanone iodide |
|---|---|
| PubChem CID | 158075429 |
| Molecular Formula | C22H26INO5 |
| Molecular Weight | 511.36 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 2-[4-(hydroxymethyl)-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-1-(2-methoxyphenyl)ethanone iodide |
| SMILES | COc1ccccc1C(=O)CC1c2c(cc3c(c2CO)OCO3)CC[N+]1(C)C.[I-] |
| InChI | InChI=1S/C22H26NO5.HI/c1-23(2)9-8-14-10-20-22(28-13-27-20)16(12-24)21(14)17(23)11-18(25)15-6-4-5-7-19(15)26-3;/h4-7,10,17,24H,8-9,11-13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | FJRYZYAEBSKTGI-UHFFFAOYSA-M |
| XLogP | -0.13 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|