C22H26B25INO5 — CID 160867346
CID 160867346 (PubChem CID 160867346) has the molecular formula C22H26B25INO5 and a molecular weight of 781.66 g/mol.
| Compound Name | CID 160867346 |
|---|---|
| PubChem CID | 160867346 |
| Molecular Formula | C22H26B25INO5 |
| Molecular Weight | 781.66 g/mol |
| Exact Mass | 786.32 |
| IUPAC Name | — |
| SMILES | COc1ccccc1C(=O)CC1c2c(cc3c(c2OC)OCO3)CC[N+]1(C)C.[B][B]B(B([B])[B])B(B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B].[I-] |
| InChI | InChI=1S/C22H26NO5.B25.HI/c1-23(2)10-9-14-11-19-21(28-13-27-19)22(26-4)20(14)16(23)12-17(24)15-7-5-6-8-18(15)25-3;1-14-21(15(2)3)24(20(12)13)25(22(16(4)5)17(6)7)23(18(8)9)19(10)11;/h5-8,11,16H,9-10,12-13H2,1-4H3;;1H/q+1;;/p-1 |
| InChIKey | XURJNNGOLPCXJQ-UHFFFAOYSA-M |
| XLogP | -9.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.66 |
| LogP ≤ 5 | -9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|